About copper;2-diphenylphosphanylethyl(diphenyl)phosphane
copper;2-diphenylphosphanylethyl(diphenyl)phosphane (PubChem CID 172691884) has the molecular formula C26H24CuP2
and a molecular weight of 461.97 g/mol. Its IUPAC name is copper;2-diphenylphosphanylethyl(diphenyl)phosphane.
Molecular Properties
| Compound Name | copper;2-diphenylphosphanylethyl(diphenyl)phosphane |
| PubChem CID | 172691884 |
| Molecular Formula | C26H24CuP2 |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | copper;2-diphenylphosphanylethyl(diphenyl)phosphane |
| SMILES | [Cu].c1ccc(P(CCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24P2.Cu/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;/h1-20H,21-22H2; |
| InChIKey | BUCLQPHYLUMEGI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper;2-diphenylphosphanylethyl(diphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;2-diphenylphosphanylethyl(diphenyl)phosphane?
The IUPAC name of copper;2-diphenylphosphanylethyl(diphenyl)phosphane (CID 172691884) is copper;2-diphenylphosphanylethyl(diphenyl)phosphane.
What is the SMILES notation for copper;2-diphenylphosphanylethyl(diphenyl)phosphane?
The canonical SMILES for copper;2-diphenylphosphanylethyl(diphenyl)phosphane is [Cu].c1ccc(P(CCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of copper;2-diphenylphosphanylethyl(diphenyl)phosphane?
The InChIKey is BUCLQPHYLUMEGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24P2.Cu/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;/h1-20H,21-22H2;.
What are the key properties of copper;2-diphenylphosphanylethyl(diphenyl)phosphane?
copper;2-diphenylphosphanylethyl(diphenyl)phosphane has a molecular weight of 461.97 g/mol, XLogP of 5.25, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2-diphenylphosphanylethyl(diphenyl)phosphane is sourced from PubChem (CID 172691884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).