About bis(2-diphenylphosphanylethyl)azanide;iron
bis(2-diphenylphosphanylethyl)azanide;iron (PubChem CID 175907105) has the molecular formula C28H28FeNP2-
and a molecular weight of 496.33 g/mol. Its IUPAC name is bis(2-diphenylphosphanylethyl)azanide;iron.
Molecular Properties
| Compound Name | bis(2-diphenylphosphanylethyl)azanide;iron |
| PubChem CID | 175907105 |
| Molecular Formula | C28H28FeNP2- |
| Molecular Weight | 496.33 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | bis(2-diphenylphosphanylethyl)azanide;iron |
| SMILES | [Fe].c1ccc(P(CC[N-]CCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H28NP2.Fe/c1-5-13-25(14-6-1)30(26-15-7-2-8-16-26)23-21-29-22-24-31(27-17-9-3-10-18-27)28-19-11-4-12-20-28;/h1-20H,21-24H2;/q-1; |
| InChIKey | DLZQHMCTBUHAPH-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.33 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2-diphenylphosphanylethyl)azanide;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-diphenylphosphanylethyl)azanide;iron?
The IUPAC name of bis(2-diphenylphosphanylethyl)azanide;iron (CID 175907105) is bis(2-diphenylphosphanylethyl)azanide;iron.
What is the SMILES notation for bis(2-diphenylphosphanylethyl)azanide;iron?
The canonical SMILES for bis(2-diphenylphosphanylethyl)azanide;iron is [Fe].c1ccc(P(CC[N-]CCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bis(2-diphenylphosphanylethyl)azanide;iron?
The InChIKey is DLZQHMCTBUHAPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28NP2.Fe/c1-5-13-25(14-6-1)30(26-15-7-2-8-16-26)23-21-29-22-24-31(27-17-9-3-10-18-27)28-19-11-4-12-20-28;/h1-20H,21-24H2;/q-1;.
What are the key properties of bis(2-diphenylphosphanylethyl)azanide;iron?
bis(2-diphenylphosphanylethyl)azanide;iron has a molecular weight of 496.33 g/mol, XLogP of 5.62, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-diphenylphosphanylethyl)azanide;iron is sourced from PubChem (CID 175907105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).