About 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride
2-diphenylphosphanylethylazanium;trifluoroborane;fluoride (PubChem CID 163196589) has the molecular formula C14H17BF4NP
and a molecular weight of 317.08 g/mol. Its IUPAC name is 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride.
Molecular Properties
| Compound Name | 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride |
| PubChem CID | 163196589 |
| Molecular Formula | C14H17BF4NP |
| Molecular Weight | 317.08 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride |
| SMILES | FB(F)F.[F-].[NH3+]CCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H16NP.BF3.FH/c15-11-12-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14;2-1(3)4;/h1-10H,11-12,15H2;;1H |
| InChIKey | BSQFFKOOHOTYMA-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.08 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride?
The IUPAC name of 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride (CID 163196589) is 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride.
What is the SMILES notation for 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride?
The canonical SMILES for 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride is FB(F)F.[F-].[NH3+]CCP(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride?
The InChIKey is BSQFFKOOHOTYMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16NP.BF3.FH/c15-11-12-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14;2-1(3)4;/h1-10H,11-12,15H2;;1H.
What are the key properties of 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride?
2-diphenylphosphanylethylazanium;trifluoroborane;fluoride has a molecular weight of 317.08 g/mol, XLogP of -0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diphenylphosphanylethylazanium;trifluoroborane;fluoride is sourced from PubChem (CID 163196589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).