About dichloronickel;bis(diphenyl(propyl)phosphane)
dichloronickel;bis(diphenyl(propyl)phosphane) (PubChem CID 87129784) has the molecular formula C30H34Cl2NiP2
and a molecular weight of 586.15 g/mol. Its IUPAC name is dichloronickel;bis(diphenyl(propyl)phosphane).
Molecular Properties
| Compound Name | dichloronickel;bis(diphenyl(propyl)phosphane) |
| PubChem CID | 87129784 |
| Molecular Formula | C30H34Cl2NiP2 |
| Molecular Weight | 586.15 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | dichloronickel;bis(diphenyl(propyl)phosphane) |
| SMILES | CCCP(c1ccccc1)c1ccccc1.CCCP(c1ccccc1)c1ccccc1.Cl[Ni]Cl |
| InChI | InChI=1S/2C15H17P.2ClH.Ni/c2*1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15;;;/h2*3-12H,2,13H2,1H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | WXSWMJGZRDCJAJ-UHFFFAOYSA-L |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.15 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloronickel;bis(diphenyl(propyl)phosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloronickel;bis(diphenyl(propyl)phosphane)?
The IUPAC name of dichloronickel;bis(diphenyl(propyl)phosphane) (CID 87129784) is dichloronickel;bis(diphenyl(propyl)phosphane).
What is the SMILES notation for dichloronickel;bis(diphenyl(propyl)phosphane)?
The canonical SMILES for dichloronickel;bis(diphenyl(propyl)phosphane) is CCCP(c1ccccc1)c1ccccc1.CCCP(c1ccccc1)c1ccccc1.Cl[Ni]Cl.
What is the InChIKey of dichloronickel;bis(diphenyl(propyl)phosphane)?
The InChIKey is WXSWMJGZRDCJAJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C15H17P.2ClH.Ni/c2*1-2-13-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15;;;/h2*3-12H,2,13H2,1H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloronickel;bis(diphenyl(propyl)phosphane)?
dichloronickel;bis(diphenyl(propyl)phosphane) has a molecular weight of 586.15 g/mol, XLogP of 8.44, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloronickel;bis(diphenyl(propyl)phosphane) is sourced from PubChem (CID 87129784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).