About ethyl(diphenyl)phosphane;trichlororuthenium
ethyl(diphenyl)phosphane;trichlororuthenium (PubChem CID 159343437) has the molecular formula C14H15Cl3PRu
and a molecular weight of 421.68 g/mol. Its IUPAC name is ethyl(diphenyl)phosphane;trichlororuthenium.
Molecular Properties
| Compound Name | ethyl(diphenyl)phosphane;trichlororuthenium |
| PubChem CID | 159343437 |
| Molecular Formula | C14H15Cl3PRu |
| Molecular Weight | 421.68 g/mol |
| Exact Mass | 420.90 |
| IUPAC Name | ethyl(diphenyl)phosphane;trichlororuthenium |
| SMILES | CCP(c1ccccc1)c1ccccc1.Cl[Ru](Cl)Cl |
| InChI | InChI=1S/C14H15P.3ClH.Ru/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;;;;/h3-12H,2H2,1H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | LGKODNHZXBHXQC-UHFFFAOYSA-K |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.68 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl(diphenyl)phosphane;trichlororuthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(diphenyl)phosphane;trichlororuthenium?
The IUPAC name of ethyl(diphenyl)phosphane;trichlororuthenium (CID 159343437) is ethyl(diphenyl)phosphane;trichlororuthenium.
What is the SMILES notation for ethyl(diphenyl)phosphane;trichlororuthenium?
The canonical SMILES for ethyl(diphenyl)phosphane;trichlororuthenium is CCP(c1ccccc1)c1ccccc1.Cl[Ru](Cl)Cl.
What is the InChIKey of ethyl(diphenyl)phosphane;trichlororuthenium?
The InChIKey is LGKODNHZXBHXQC-UHFFFAOYSA-K. The full InChI is InChI=1S/C14H15P.3ClH.Ru/c1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;;;;/h3-12H,2H2,1H3;3*1H;/q;;;;+3/p-3.
What are the key properties of ethyl(diphenyl)phosphane;trichlororuthenium?
ethyl(diphenyl)phosphane;trichlororuthenium has a molecular weight of 421.68 g/mol, XLogP of 5.21, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(diphenyl)phosphane;trichlororuthenium is sourced from PubChem (CID 159343437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).