About dichloropalladium;bis(ethyl(diphenyl)phosphane)
dichloropalladium;bis(ethyl(diphenyl)phosphane) (PubChem CID 22638849) has the molecular formula C28H28Cl2P2Pd-2
and a molecular weight of 603.81 g/mol. Its IUPAC name is dichloropalladium;bis(ethyl(diphenyl)phosphane).
Molecular Properties
| Compound Name | dichloropalladium;bis(ethyl(diphenyl)phosphane) |
| PubChem CID | 22638849 |
| Molecular Formula | C28H28Cl2P2Pd-2 |
| Molecular Weight | 603.81 g/mol |
| Exact Mass | 602.01 |
| IUPAC Name | dichloropalladium;bis(ethyl(diphenyl)phosphane) |
| SMILES | Cl[Pd]Cl.[CH2-]CP(c1ccccc1)c1ccccc1.[CH2-]CP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C14H14P.2ClH.Pd/c2*1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;;;/h2*3-12H,1-2H2;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | DQGWZPUNACPNTP-UHFFFAOYSA-L |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 603.81 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloropalladium;bis(ethyl(diphenyl)phosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloropalladium;bis(ethyl(diphenyl)phosphane)?
The IUPAC name of dichloropalladium;bis(ethyl(diphenyl)phosphane) (CID 22638849) is dichloropalladium;bis(ethyl(diphenyl)phosphane).
What is the SMILES notation for dichloropalladium;bis(ethyl(diphenyl)phosphane)?
The canonical SMILES for dichloropalladium;bis(ethyl(diphenyl)phosphane) is Cl[Pd]Cl.[CH2-]CP(c1ccccc1)c1ccccc1.[CH2-]CP(c1ccccc1)c1ccccc1.
What is the InChIKey of dichloropalladium;bis(ethyl(diphenyl)phosphane)?
The InChIKey is DQGWZPUNACPNTP-UHFFFAOYSA-L. The full InChI is InChI=1S/2C14H14P.2ClH.Pd/c2*1-2-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14;;;/h2*3-12H,1-2H2;2*1H;/q2*-1;;;+2/p-2.
What are the key properties of dichloropalladium;bis(ethyl(diphenyl)phosphane)?
dichloropalladium;bis(ethyl(diphenyl)phosphane) has a molecular weight of 603.81 g/mol, XLogP of 7.28, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloropalladium;bis(ethyl(diphenyl)phosphane) is sourced from PubChem (CID 22638849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).