About 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+)
3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+) (PubChem CID 134888828) has the molecular formula C34H40P2Pt
and a molecular weight of 705.72 g/mol. Its IUPAC name is 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+).
Molecular Properties
| Compound Name | 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+) |
| PubChem CID | 134888828 |
| Molecular Formula | C34H40P2Pt |
| Molecular Weight | 705.72 g/mol |
| Exact Mass | 705.23 |
| IUPAC Name | 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+) |
| SMILES | [CH2-]CCCCC[CH2-].[Pt+2].c1ccc(P(CCCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26P2.C7H14.Pt/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27;1-3-5-7-6-4-2;/h1-12,14-21H,13,22-23H2;1-7H2;/q;-2;+2 |
| InChIKey | KXIREJCPEIQMNX-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 705.72 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+)?
The IUPAC name of 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+) (CID 134888828) is 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+).
What is the SMILES notation for 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+)?
The canonical SMILES for 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+) is [CH2-]CCCCC[CH2-].[Pt+2].c1ccc(P(CCCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+)?
The InChIKey is KXIREJCPEIQMNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H26P2.C7H14.Pt/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27;1-3-5-7-6-4-2;/h1-12,14-21H,13,22-23H2;1-7H2;/q;-2;+2.
What are the key properties of 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+)?
3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+) has a molecular weight of 705.72 g/mol, XLogP of 8.24, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diphenylphosphanylpropyl(diphenyl)phosphane;heptane;platinum(2+) is sourced from PubChem (CID 134888828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).