C18H22Na2O3P2 — CID 101086427
disodium;6-diphenylphosphanylhexyl(trioxido)phosphanium (PubChem CID 101086427) has the molecular formula C18H22Na2O3P2 and a molecular weight of 394.30 g/mol. Its IUPAC name is disodium;6-diphenylphosphanylhexyl(trioxido)phosphanium.
| Compound Name | disodium;6-diphenylphosphanylhexyl(trioxido)phosphanium |
|---|---|
| PubChem CID | 101086427 |
| Molecular Formula | C18H22Na2O3P2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | disodium;6-diphenylphosphanylhexyl(trioxido)phosphanium |
| SMILES | [Na+].[Na+].[O-][P+]([O-])([O-])CCCCCCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H24O3P2.2Na/c19-23(20,21)16-10-2-1-9-15-22(17-11-5-3-6-12-17)18-13-7-4-8-14-18;;/h3-8,11-14H,1-2,9-10,15-16H2,(H2,19,20,21);;/q;2*+1/p-2 |
| InChIKey | BDJUJZMWSFCULY-UHFFFAOYSA-L |
| XLogP | -4.47 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|