C30H34O3P2S — CID 88698780
4-diphenylphosphanylbutyl-methyl-diphenylphosphanium;methanesulfonate (PubChem CID 88698780) has the molecular formula C30H34O3P2S and a molecular weight of 536.61 g/mol. Its IUPAC name is 4-diphenylphosphanylbutyl-methyl-diphenylphosphanium;methanesulfonate.
| Compound Name | 4-diphenylphosphanylbutyl-methyl-diphenylphosphanium;methanesulfonate |
|---|---|
| PubChem CID | 88698780 |
| Molecular Formula | C30H34O3P2S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 4-diphenylphosphanylbutyl-methyl-diphenylphosphanium;methanesulfonate |
| SMILES | CS(=O)(=O)[O-].C[P+](CCCCP(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H31P2.CH4O3S/c1-31(28-20-10-4-11-21-28,29-22-12-5-13-23-29)25-15-14-24-30(26-16-6-2-7-17-26)27-18-8-3-9-19-27;1-5(2,3)4/h2-13,16-23H,14-15,24-25H2,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | GMUBQZZMDKQUOH-UHFFFAOYSA-M |
| XLogP | 5.36 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|