About dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane
dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane (PubChem CID 11377369) has the molecular formula C30H32Br2CoP2
and a molecular weight of 673.28 g/mol. Its IUPAC name is dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane.
Molecular Properties
| Compound Name | dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane |
| PubChem CID | 11377369 |
| Molecular Formula | C30H32Br2CoP2 |
| Molecular Weight | 673.28 g/mol |
| Exact Mass | 670.97 |
| IUPAC Name | dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane |
| SMILES | Br[Co]Br.c1ccc(P(CCCCCCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H32P2.2BrH.Co/c1(15-25-31(27-17-7-3-8-18-27)28-19-9-4-10-20-28)2-16-26-32(29-21-11-5-12-22-29)30-23-13-6-14-24-30;;;/h3-14,17-24H,1-2,15-16,25-26H2;2*1H;/q;;;+2/p-2 |
| InChIKey | KWZNTCWIIIDGEX-UHFFFAOYSA-L |
| XLogP | 8.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 673.28 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane?
The IUPAC name of dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane (CID 11377369) is dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane.
What is the SMILES notation for dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane?
The canonical SMILES for dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane is Br[Co]Br.c1ccc(P(CCCCCCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane?
The InChIKey is KWZNTCWIIIDGEX-UHFFFAOYSA-L. The full InChI is InChI=1S/C30H32P2.2BrH.Co/c1(15-25-31(27-17-7-3-8-18-27)28-19-9-4-10-20-28)2-16-26-32(29-21-11-5-12-22-29)30-23-13-6-14-24-30;;;/h3-14,17-24H,1-2,15-16,25-26H2;2*1H;/q;;;+2/p-2.
What are the key properties of dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane?
dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane has a molecular weight of 673.28 g/mol, XLogP of 8.50, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibromocobalt;6-diphenylphosphanylhexyl(diphenyl)phosphane is sourced from PubChem (CID 11377369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).