C28H24O12P2S4-4 — CID 102224070
3-[4-bis(3-sulfonatophenyl)phosphanylbutyl-(3-sulfonatophenyl)phosphanyl]benzenesulfonate (PubChem CID 102224070) has the molecular formula C28H24O12P2S4-4 and a molecular weight of 742.70 g/mol. Its IUPAC name is 3-[4-bis(3-sulfonatophenyl)phosphanylbutyl-(3-sulfonatophenyl)phosphanyl]benzenesulfonate.
| Compound Name | 3-[4-bis(3-sulfonatophenyl)phosphanylbutyl-(3-sulfonatophenyl)phosphanyl]benzenesulfonate |
|---|---|
| PubChem CID | 102224070 |
| Molecular Formula | C28H24O12P2S4-4 |
| Molecular Weight | 742.70 g/mol |
| Exact Mass | 741.96 |
| IUPAC Name | 3-[4-bis(3-sulfonatophenyl)phosphanylbutyl-(3-sulfonatophenyl)phosphanyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1cccc(P(CCCCP(c2cccc(S(=O)(=O)[O-])c2)c2cccc(S(=O)(=O)[O-])c2)c2cccc(S(=O)(=O)[O-])c2)c1 |
| InChI | InChI=1S/C28H28O12P2S4/c29-43(30,31)25-11-3-7-21(17-25)41(22-8-4-12-26(18-22)44(32,33)34)15-1-2-16-42(23-9-5-13-27(19-23)45(35,36)37)24-10-6-14-28(20-24)46(38,39)40/h3-14,17-20H,1-2,15-16H2,(H,29,30,31)(H,32,33,34)(H,35,36,37)(H,38,39,40)/p-4 |
| InChIKey | FBLQYZUYQXQAEQ-UHFFFAOYSA-J |
| XLogP | 1.65 |
| TPSA | 228.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.70 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|