C28H26Na2O6P2S2 — CID 14647533
disodium;3-[phenyl-[3-[phenyl-(3-sulfonatophenyl)phosphanyl]butan-2-yl]phosphanyl]benzenesulfonate (PubChem CID 14647533) has the molecular formula C28H26Na2O6P2S2 and a molecular weight of 630.57 g/mol. Its IUPAC name is disodium;3-[phenyl-[3-[phenyl-(3-sulfonatophenyl)phosphanyl]butan-2-yl]phosphanyl]benzenesulfonate.
| Compound Name | disodium;3-[phenyl-[3-[phenyl-(3-sulfonatophenyl)phosphanyl]butan-2-yl]phosphanyl]benzenesulfonate |
|---|---|
| PubChem CID | 14647533 |
| Molecular Formula | C28H26Na2O6P2S2 |
| Molecular Weight | 630.57 g/mol |
| Exact Mass | 630.04 |
| IUPAC Name | disodium;3-[phenyl-[3-[phenyl-(3-sulfonatophenyl)phosphanyl]butan-2-yl]phosphanyl]benzenesulfonate |
| SMILES | CC(C(C)P(c1ccccc1)c1cccc(S(=O)(=O)[O-])c1)P(c1ccccc1)c1cccc(S(=O)(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C28H28O6P2S2.2Na/c1-21(35(23-11-5-3-6-12-23)25-15-9-17-27(19-25)37(29,30)31)22(2)36(24-13-7-4-8-14-24)26-16-10-18-28(20-26)38(32,33)34;;/h3-22H,1-2H3,(H,29,30,31)(H,32,33,34);;/q;2*+1/p-2 |
| InChIKey | LYDMWTGSLBQCFS-UHFFFAOYSA-L |
| XLogP | -2.15 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.57 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|