C28H28O12P2S4 — CID 14387963
3-[3-bis(3-sulfophenyl)phosphanylbutan-2-yl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid (PubChem CID 14387963) has the molecular formula C28H28O12P2S4 and a molecular weight of 746.74 g/mol. Its IUPAC name is 3-[3-bis(3-sulfophenyl)phosphanylbutan-2-yl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid.
| Compound Name | 3-[3-bis(3-sulfophenyl)phosphanylbutan-2-yl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 14387963 |
| Molecular Formula | C28H28O12P2S4 |
| Molecular Weight | 746.74 g/mol |
| Exact Mass | 745.99 |
| IUPAC Name | 3-[3-bis(3-sulfophenyl)phosphanylbutan-2-yl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid |
| SMILES | CC(C(C)P(c1cccc(S(=O)(=O)O)c1)c1cccc(S(=O)(=O)O)c1)P(c1cccc(S(=O)(=O)O)c1)c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C28H28O12P2S4/c1-19(41(21-7-3-11-25(15-21)43(29,30)31)22-8-4-12-26(16-22)44(32,33)34)20(2)42(23-9-5-13-27(17-23)45(35,36)37)24-10-6-14-28(18-24)46(38,39)40/h3-20H,1-2H3,(H,29,30,31)(H,32,33,34)(H,35,36,37)(H,38,39,40) |
| InChIKey | IJHWIAIOFVPZQY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 217.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.74 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|