About but-2-ene;3-methoxybenzenesulfonic acid
but-2-ene;3-methoxybenzenesulfonic acid (PubChem CID 175366995) has the molecular formula C11H16O4S
and a molecular weight of 244.31 g/mol. Its IUPAC name is but-2-ene;3-methoxybenzenesulfonic acid.
Molecular Properties
| Compound Name | but-2-ene;3-methoxybenzenesulfonic acid |
| PubChem CID | 175366995 |
| Molecular Formula | C11H16O4S |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | but-2-ene;3-methoxybenzenesulfonic acid |
| SMILES | CC=CC.COc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C7H8O4S.C4H8/c1-11-6-3-2-4-7(5-6)12(8,9)10;1-3-4-2/h2-5H,1H3,(H,8,9,10);3-4H,1-2H3 |
| InChIKey | YSJZDYYQLZGAFS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze but-2-ene;3-methoxybenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-ene;3-methoxybenzenesulfonic acid?
The IUPAC name of but-2-ene;3-methoxybenzenesulfonic acid (CID 175366995) is but-2-ene;3-methoxybenzenesulfonic acid.
What is the SMILES notation for but-2-ene;3-methoxybenzenesulfonic acid?
The canonical SMILES for but-2-ene;3-methoxybenzenesulfonic acid is CC=CC.COc1cccc(S(=O)(=O)O)c1.
What is the InChIKey of but-2-ene;3-methoxybenzenesulfonic acid?
The InChIKey is YSJZDYYQLZGAFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4S.C4H8/c1-11-6-3-2-4-7(5-6)12(8,9)10;1-3-4-2/h2-5H,1H3,(H,8,9,10);3-4H,1-2H3.
What are the key properties of but-2-ene;3-methoxybenzenesulfonic acid?
but-2-ene;3-methoxybenzenesulfonic acid has a molecular weight of 244.31 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-ene;3-methoxybenzenesulfonic acid is sourced from PubChem (CID 175366995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).