but-2-ene;3-methoxybenzenesulfonic acid

C11H16O4S — CID 175366995

IUPACbut-2-ene;3-methoxybenzenesulfonic acid
SMILESCC=CC.COc1cccc(S(=O)(=O)O)c1
InChIInChI=1S/C7H8O4S.C4H8/c1-11-6-3-2-4-7(5-6)12(8,9)10;1-3-4-2/h2-5H,1H3,(H,8,9,10);3-4H,1-2H3
InChIKeyYSJZDYYQLZGAFS-UHFFFAOYSA-N
MW244.31 g/mol
LogP2.52
Rot. Bonds2

About but-2-ene;3-methoxybenzenesulfonic acid

but-2-ene;3-methoxybenzenesulfonic acid (PubChem CID 175366995) has the molecular formula C11H16O4S and a molecular weight of 244.31 g/mol. Its IUPAC name is but-2-ene;3-methoxybenzenesulfonic acid.

Molecular Properties

Compound Namebut-2-ene;3-methoxybenzenesulfonic acid
PubChem CID175366995
Molecular FormulaC11H16O4S
Molecular Weight244.31 g/mol
Exact Mass244.08
IUPAC Namebut-2-ene;3-methoxybenzenesulfonic acid
SMILESCC=CC.COc1cccc(S(=O)(=O)O)c1
InChIInChI=1S/C7H8O4S.C4H8/c1-11-6-3-2-4-7(5-6)12(8,9)10;1-3-4-2/h2-5H,1H3,(H,8,9,10);3-4H,1-2H3
InChIKeyYSJZDYYQLZGAFS-UHFFFAOYSA-N
XLogP2.52
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.31
LogP ≤ 52.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze but-2-ene;3-methoxybenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of but-2-ene;3-methoxybenzenesulfonic acid?
The IUPAC name of but-2-ene;3-methoxybenzenesulfonic acid (CID 175366995) is but-2-ene;3-methoxybenzenesulfonic acid.
What is the SMILES notation for but-2-ene;3-methoxybenzenesulfonic acid?
The canonical SMILES for but-2-ene;3-methoxybenzenesulfonic acid is CC=CC.COc1cccc(S(=O)(=O)O)c1.
What is the InChIKey of but-2-ene;3-methoxybenzenesulfonic acid?
The InChIKey is YSJZDYYQLZGAFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4S.C4H8/c1-11-6-3-2-4-7(5-6)12(8,9)10;1-3-4-2/h2-5H,1H3,(H,8,9,10);3-4H,1-2H3.
What are the key properties of but-2-ene;3-methoxybenzenesulfonic acid?
but-2-ene;3-methoxybenzenesulfonic acid has a molecular weight of 244.31 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-ene;3-methoxybenzenesulfonic acid is sourced from PubChem (CID 175366995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).