C22H11F12NaO3PS — CID 87292960
DAN2PHOS (PubChem CID 87292960) has the molecular formula C22H11F12NaO3PS and a molecular weight of 637.33 g/mol.
| Compound Name | DAN2PHOS |
|---|---|
| PubChem CID | 87292960 |
| Molecular Formula | C22H11F12NaO3PS |
| Molecular Weight | 637.33 g/mol |
| Exact Mass | 636.99 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cccc(P(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1.[Na] |
| InChI | InChI=1S/C22H11F12O3PS.Na/c23-19(24,25)11-4-12(20(26,27)28)7-16(6-11)38(15-2-1-3-18(10-15)39(35,36)37)17-8-13(21(29,30)31)5-14(9-17)22(32,33)34;/h1-10H,(H,35,36,37); |
| InChIKey | PNEGKWFSVNZASD-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.33 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|