About gold;trifluoromethanesulfonic acid;triphenylphosphane
gold;trifluoromethanesulfonic acid;triphenylphosphane (PubChem CID 158410335) has the molecular formula C19H16AuF3O3PS
and a molecular weight of 609.34 g/mol. Its IUPAC name is gold;trifluoromethanesulfonic acid;triphenylphosphane.
Molecular Properties
| Compound Name | gold;trifluoromethanesulfonic acid;triphenylphosphane |
| PubChem CID | 158410335 |
| Molecular Formula | C19H16AuF3O3PS |
| Molecular Weight | 609.34 g/mol |
| Exact Mass | 609.02 |
| IUPAC Name | gold;trifluoromethanesulfonic acid;triphenylphosphane |
| SMILES | O=S(=O)(O)C(F)(F)F.[Au].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.CHF3O3S.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)8(5,6)7;/h1-15H;(H,5,6,7); |
| InChIKey | GZFORZTVPTXAKH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 609.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze gold;trifluoromethanesulfonic acid;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold;trifluoromethanesulfonic acid;triphenylphosphane?
The IUPAC name of gold;trifluoromethanesulfonic acid;triphenylphosphane (CID 158410335) is gold;trifluoromethanesulfonic acid;triphenylphosphane.
What is the SMILES notation for gold;trifluoromethanesulfonic acid;triphenylphosphane?
The canonical SMILES for gold;trifluoromethanesulfonic acid;triphenylphosphane is O=S(=O)(O)C(F)(F)F.[Au].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of gold;trifluoromethanesulfonic acid;triphenylphosphane?
The InChIKey is GZFORZTVPTXAKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.CHF3O3S.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)8(5,6)7;/h1-15H;(H,5,6,7);.
What are the key properties of gold;trifluoromethanesulfonic acid;triphenylphosphane?
gold;trifluoromethanesulfonic acid;triphenylphosphane has a molecular weight of 609.34 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold;trifluoromethanesulfonic acid;triphenylphosphane is sourced from PubChem (CID 158410335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).