C18H15O6PS2 — CID 4303689
4-[phenyl-(4-sulfophenyl)phosphanyl]benzenesulfonic acid (PubChem CID 4303689) has the molecular formula C18H15O6PS2 and a molecular weight of 422.42 g/mol. Its IUPAC name is 4-[phenyl-(4-sulfophenyl)phosphanyl]benzenesulfonic acid.
| Compound Name | 4-[phenyl-(4-sulfophenyl)phosphanyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 4303689 |
| Molecular Formula | C18H15O6PS2 |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | 4-[phenyl-(4-sulfophenyl)phosphanyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(P(c2ccccc2)c2ccc(S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H15O6PS2/c19-26(20,21)17-10-6-15(7-11-17)25(14-4-2-1-3-5-14)16-8-12-18(13-9-16)27(22,23)24/h1-13H,(H,19,20,21)(H,22,23,24) |
| InChIKey | HEMCNETVISWSCS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|