About 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate
4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate (PubChem CID 118878602) has the molecular formula C20H23O5PS2
and a molecular weight of 438.51 g/mol. Its IUPAC name is 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate.
Molecular Properties
| Compound Name | 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate |
| PubChem CID | 118878602 |
| Molecular Formula | C20H23O5PS2 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate |
| SMILES | CS(C)=O.O.O=S(=O)(O)c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15O3PS.C2H6OS.H2O/c19-23(20,21)18-13-11-17(12-14-18)22(15-7-3-1-4-8-15)16-9-5-2-6-10-16;1-4(2)3;/h1-14H,(H,19,20,21);1-2H3;1H2 |
| InChIKey | IMMRUYGTTVBIDK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 102.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate?
The IUPAC name of 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate (CID 118878602) is 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate.
What is the SMILES notation for 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate?
The canonical SMILES for 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate is CS(C)=O.O.O=S(=O)(O)c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate?
The InChIKey is IMMRUYGTTVBIDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15O3PS.C2H6OS.H2O/c19-23(20,21)18-13-11-17(12-14-18)22(15-7-3-1-4-8-15)16-9-5-2-6-10-16;1-4(2)3;/h1-14H,(H,19,20,21);1-2H3;1H2.
What are the key properties of 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate?
4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate has a molecular weight of 438.51 g/mol, XLogP of 1.86, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diphenylphosphanylbenzenesulfonic acid;methylsulfinylmethane;hydrate is sourced from PubChem (CID 118878602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).