C18H21N2O6PS2 — CID 173085808
azane;3-[phenyl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid (PubChem CID 173085808) has the molecular formula C18H21N2O6PS2 and a molecular weight of 456.48 g/mol. Its IUPAC name is azane;3-[phenyl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid.
| Compound Name | azane;3-[phenyl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 173085808 |
| Molecular Formula | C18H21N2O6PS2 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | azane;3-[phenyl-(3-sulfophenyl)phosphanyl]benzenesulfonic acid |
| SMILES | N.N.O=S(=O)(O)c1cccc(P(c2ccccc2)c2cccc(S(=O)(=O)O)c2)c1 |
| InChI | InChI=1S/C18H15O6PS2.2H3N/c19-26(20,21)17-10-4-8-15(12-17)25(14-6-2-1-3-7-14)16-9-5-11-18(13-16)27(22,23)24;;/h1-13H,(H,19,20,21)(H,22,23,24);2*1H3 |
| InChIKey | IYWPNDVWSWDZIG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 178.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|