C18H15O9PS3 — CID 23531400
3-bis[3-(trioxidanylsulfanyl)phenyl]phosphanylbenzenesulfonic acid (PubChem CID 23531400) has the molecular formula C18H15O9PS3 and a molecular weight of 502.48 g/mol. Its IUPAC name is 3-bis[3-(trioxidanylsulfanyl)phenyl]phosphanylbenzenesulfonic acid.
| Compound Name | 3-bis[3-(trioxidanylsulfanyl)phenyl]phosphanylbenzenesulfonic acid |
|---|---|
| PubChem CID | 23531400 |
| Molecular Formula | C18H15O9PS3 |
| Molecular Weight | 502.48 g/mol |
| Exact Mass | 501.96 |
| IUPAC Name | 3-bis[3-(trioxidanylsulfanyl)phenyl]phosphanylbenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(P(c2cccc(SOOO)c2)c2cccc(SOOO)c2)c1 |
| InChI | InChI=1S/C18H15O9PS3/c19-24-26-29-16-7-1-4-13(10-16)28(14-5-2-8-17(11-14)30-27-25-20)15-6-3-9-18(12-15)31(21,22)23/h1-12,19-20H,(H,21,22,23) |
| InChIKey | BDXMQJJHRDQHMU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|