C19H18NO9S3+ — CID 21023417
methyl-bis(3-sulfophenyl)-[3-(trioxidanylsulfanyl)phenyl]azanium (PubChem CID 21023417) has the molecular formula C19H18NO9S3+ and a molecular weight of 500.55 g/mol. Its IUPAC name is methyl-bis(3-sulfophenyl)-[3-(trioxidanylsulfanyl)phenyl]azanium.
| Compound Name | methyl-bis(3-sulfophenyl)-[3-(trioxidanylsulfanyl)phenyl]azanium |
|---|---|
| PubChem CID | 21023417 |
| Molecular Formula | C19H18NO9S3+ |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | methyl-bis(3-sulfophenyl)-[3-(trioxidanylsulfanyl)phenyl]azanium |
| SMILES | C[N+](c1cccc(SOOO)c1)(c1cccc(S(=O)(=O)O)c1)c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C19H17NO9S3/c1-20(14-5-2-8-17(11-14)30-29-28-21,15-6-3-9-18(12-15)31(22,23)24)16-7-4-10-19(13-16)32(25,26)27/h2-13H,1H3,(H2-,21,22,23,24,25,26,27)/p+1 |
| InChIKey | RYEVPUCZUXWCNU-UHFFFAOYSA-O |
| XLogP | 4.21 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|