C9H12O7S2 — CID 21305692
2-(3-hydroxypropyl)-5-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 21305692) has the molecular formula C9H12O7S2 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-(3-hydroxypropyl)-5-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 2-(3-hydroxypropyl)-5-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 21305692 |
| Molecular Formula | C9H12O7S2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 2-(3-hydroxypropyl)-5-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(SOOO)ccc1CCCO |
| InChI | InChI=1S/C9H12O7S2/c10-5-1-2-7-3-4-8(17-16-15-11)6-9(7)18(12,13)14/h3-4,6,10-11H,1-2,5H2,(H,12,13,14) |
| InChIKey | UMAURHWNZXCXQM-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|