C11H13N3O8S3 — CID 58907959
2-[3-methyl-5-(methylsulfamoyl)pyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 58907959) has the molecular formula C11H13N3O8S3 and a molecular weight of 411.44 g/mol. Its IUPAC name is 2-[3-methyl-5-(methylsulfamoyl)pyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 2-[3-methyl-5-(methylsulfamoyl)pyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 58907959 |
| Molecular Formula | C11H13N3O8S3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 2-[3-methyl-5-(methylsulfamoyl)pyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | CNS(=O)(=O)c1cc(C)nn1-c1cc(SOOO)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C11H13N3O8S3/c1-7-5-11(24(16,17)12-2)14(13-7)9-6-8(23-22-21-15)3-4-10(9)25(18,19)20/h3-6,12,15H,1-2H3,(H,18,19,20) |
| InChIKey | HAHJEIHTYPZFHW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 157.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|