C8H10O7S2 — CID 58611266
5-methoxy-2-methyl-4-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 58611266) has the molecular formula C8H10O7S2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-methoxy-2-methyl-4-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 5-methoxy-2-methyl-4-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 58611266 |
| Molecular Formula | C8H10O7S2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 5-methoxy-2-methyl-4-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | COc1cc(S(=O)(=O)O)c(C)cc1SOOO |
| InChI | InChI=1S/C8H10O7S2/c1-5-3-7(16-15-14-9)6(13-2)4-8(5)17(10,11)12/h3-4,9H,1-2H3,(H,10,11,12) |
| InChIKey | WEPGZTLSMBUZIW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|