C7H8O11S3 — CID 14199597
2-methoxy-5-sulfooxybenzene-1,4-disulfonic acid (PubChem CID 14199597) has the molecular formula C7H8O11S3 and a molecular weight of 364.33 g/mol. Its IUPAC name is 2-methoxy-5-sulfooxybenzene-1,4-disulfonic acid.
| Compound Name | 2-methoxy-5-sulfooxybenzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 14199597 |
| Molecular Formula | C7H8O11S3 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 2-methoxy-5-sulfooxybenzene-1,4-disulfonic acid |
| SMILES | COc1cc(S(=O)(=O)O)c(OS(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C7H8O11S3/c1-17-4-2-7(20(11,12)13)5(18-21(14,15)16)3-6(4)19(8,9)10/h2-3H,1H3,(H,8,9,10)(H,11,12,13)(H,14,15,16) |
| InChIKey | VKFMCMUXJFSZMF-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 181.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|