C7H8O8S2 — CID 14197010
4-hydroxy-6-methoxybenzene-1,3-disulfonic acid (PubChem CID 14197010) has the molecular formula C7H8O8S2 and a molecular weight of 284.27 g/mol. Its IUPAC name is 4-hydroxy-6-methoxybenzene-1,3-disulfonic acid.
| Compound Name | 4-hydroxy-6-methoxybenzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 14197010 |
| Molecular Formula | C7H8O8S2 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 4-hydroxy-6-methoxybenzene-1,3-disulfonic acid |
| SMILES | COc1cc(O)c(S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C7H8O8S2/c1-15-5-2-4(8)6(16(9,10)11)3-7(5)17(12,13)14/h2-3,8H,1H3,(H,9,10,11)(H,12,13,14) |
| InChIKey | SYLBUPLSVFJNBR-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|