C14H12O7S — CID 20829569
4-hydroxy-5-(2-hydroxybenzoyl)-2-methoxybenzenesulfonic acid (PubChem CID 20829569) has the molecular formula C14H12O7S and a molecular weight of 324.31 g/mol. Its IUPAC name is 4-hydroxy-5-(2-hydroxybenzoyl)-2-methoxybenzenesulfonic acid.
| Compound Name | 4-hydroxy-5-(2-hydroxybenzoyl)-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 20829569 |
| Molecular Formula | C14H12O7S |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 4-hydroxy-5-(2-hydroxybenzoyl)-2-methoxybenzenesulfonic acid |
| SMILES | COc1cc(O)c(C(=O)c2ccccc2O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C14H12O7S/c1-21-12-7-11(16)9(6-13(12)22(18,19)20)14(17)8-4-2-3-5-10(8)15/h2-7,15-16H,1H3,(H,18,19,20) |
| InChIKey | PBJRYJIBGCDGNM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|