C15H13NaO8S — CID 23678865
sodium 4-hydroxy-5-(2-hydroxy-4-methoxybenzoyl)-2-methoxybenzenesulfonate (PubChem CID 23678865) has the molecular formula C15H13NaO8S and a molecular weight of 376.32 g/mol. Its IUPAC name is sodium 4-hydroxy-5-(2-hydroxy-4-methoxybenzoyl)-2-methoxybenzenesulfonate.
| Compound Name | sodium 4-hydroxy-5-(2-hydroxy-4-methoxybenzoyl)-2-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 23678865 |
| Molecular Formula | C15H13NaO8S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | sodium 4-hydroxy-5-(2-hydroxy-4-methoxybenzoyl)-2-methoxybenzenesulfonate |
| SMILES | COc1ccc(C(=O)c2cc(S(=O)(=O)[O-])c(OC)cc2O)c(O)c1.[Na+] |
| InChI | InChI=1S/C15H14O8S.Na/c1-22-8-3-4-9(11(16)5-8)15(18)10-6-14(24(19,20)21)13(23-2)7-12(10)17;/h3-7,16-17H,1-2H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | NHZIBLPDGIARQC-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|