C15H14O8S — CID 23208531
2-hydroxy-3-(2-hydroxy-4-methoxybenzoyl)-6-methoxybenzenesulfonic acid (PubChem CID 23208531) has the molecular formula C15H14O8S and a molecular weight of 354.34 g/mol. Its IUPAC name is 2-hydroxy-3-(2-hydroxy-4-methoxybenzoyl)-6-methoxybenzenesulfonic acid.
| Compound Name | 2-hydroxy-3-(2-hydroxy-4-methoxybenzoyl)-6-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 23208531 |
| Molecular Formula | C15H14O8S |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2-hydroxy-3-(2-hydroxy-4-methoxybenzoyl)-6-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(C(=O)c2ccc(OC)c(S(=O)(=O)O)c2O)c(O)c1 |
| InChI | InChI=1S/C15H14O8S/c1-22-8-3-4-9(11(16)7-8)13(17)10-5-6-12(23-2)15(14(10)18)24(19,20)21/h3-7,16,18H,1-2H3,(H,19,20,21) |
| InChIKey | VUOGCOGSGYCOLQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|