C8H8O6S — CID 141261385
(2-hydroxy-4-methoxyphenyl)-oxomethanesulfonic acid (PubChem CID 141261385) has the molecular formula C8H8O6S and a molecular weight of 232.21 g/mol. Its IUPAC name is (2-hydroxy-4-methoxyphenyl)-oxomethanesulfonic acid.
| Compound Name | (2-hydroxy-4-methoxyphenyl)-oxomethanesulfonic acid |
|---|---|
| PubChem CID | 141261385 |
| Molecular Formula | C8H8O6S |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | (2-hydroxy-4-methoxyphenyl)-oxomethanesulfonic acid |
| SMILES | COc1ccc(C(=O)S(=O)(=O)O)c(O)c1 |
| InChI | InChI=1S/C8H8O6S/c1-14-5-2-3-6(7(9)4-5)8(10)15(11,12)13/h2-4,9H,1H3,(H,11,12,13) |
| InChIKey | FEIVFRAXFBYIPU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|