C11H10O5 — CID 12741452
(E)-4-(2-hydroxy-4-methoxyphenyl)-4-oxobut-2-enoic acid (PubChem CID 12741452) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is (E)-4-(2-hydroxy-4-methoxyphenyl)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(2-hydroxy-4-methoxyphenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 12741452 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | (E)-4-(2-hydroxy-4-methoxyphenyl)-4-oxobut-2-enoic acid |
| SMILES | COc1ccc(C(=O)/C=C/C(=O)O)c(O)c1 |
| InChI | InChI=1S/C11H10O5/c1-16-7-2-3-8(10(13)6-7)9(12)4-5-11(14)15/h2-6,13H,1H3,(H,14,15)/b5-4+ |
| InChIKey | JAGWGYMZWHJUST-SNAWJCMRSA-N |
| XLogP | 1.22 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|