C21H23NO4 — CID 46227283
(E)-1-(2-hydroxy-4-methoxyphenyl)-3-[4-(4-hydroxyphenyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 46227283) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is (E)-1-(2-hydroxy-4-methoxyphenyl)-3-[4-(4-hydroxyphenyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(2-hydroxy-4-methoxyphenyl)-3-[4-(4-hydroxyphenyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 46227283 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (E)-1-(2-hydroxy-4-methoxyphenyl)-3-[4-(4-hydroxyphenyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/N2CCC(c3ccc(O)cc3)CC2)c(O)c1 |
| InChI | InChI=1S/C21H23NO4/c1-26-18-6-7-19(21(25)14-18)20(24)10-13-22-11-8-16(9-12-22)15-2-4-17(23)5-3-15/h2-7,10,13-14,16,23,25H,8-9,11-12H2,1H3/b13-10+ |
| InChIKey | GLQUMGPPRFXYKE-JLHYYAGUSA-N |
| XLogP | 3.68 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|