C12H14O3S2 — CID 10802003
1-(2-hydroxy-4-methoxyphenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one (PubChem CID 10802003) has the molecular formula C12H14O3S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-(2-hydroxy-4-methoxyphenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one.
| Compound Name | 1-(2-hydroxy-4-methoxyphenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 10802003 |
| Molecular Formula | C12H14O3S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 1-(2-hydroxy-4-methoxyphenyl)-3,3-bis(methylsulfanyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)C=C(SC)SC)c(O)c1 |
| InChI | InChI=1S/C12H14O3S2/c1-15-8-4-5-9(10(13)6-8)11(14)7-12(16-2)17-3/h4-7,13H,1-3H3 |
| InChIKey | SHZDSNPMKOEBEL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|