C20H22O4S2 — CID 126484430
1-[2-methoxy-4-[(4-methoxyphenyl)methoxy]phenyl]-3,3-bis(methylsulfanyl)prop-2-en-1-one (PubChem CID 126484430) has the molecular formula C20H22O4S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-[2-methoxy-4-[(4-methoxyphenyl)methoxy]phenyl]-3,3-bis(methylsulfanyl)prop-2-en-1-one.
| Compound Name | 1-[2-methoxy-4-[(4-methoxyphenyl)methoxy]phenyl]-3,3-bis(methylsulfanyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 126484430 |
| Molecular Formula | C20H22O4S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 1-[2-methoxy-4-[(4-methoxyphenyl)methoxy]phenyl]-3,3-bis(methylsulfanyl)prop-2-en-1-one |
| SMILES | COc1ccc(COc2ccc(C(=O)C=C(SC)SC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H22O4S2/c1-22-15-7-5-14(6-8-15)13-24-16-9-10-17(19(11-16)23-2)18(21)12-20(25-3)26-4/h5-12H,13H2,1-4H3 |
| InChIKey | FQXSAVJHAPHIRW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|