C15H14O11S2 — CID 21477999
2-hydroxy-6-(3-hydroxy-4-methoxy-2-sulfobenzoyl)-3-methoxybenzenesulfonic acid (PubChem CID 21477999) has the molecular formula C15H14O11S2 and a molecular weight of 434.40 g/mol. Its IUPAC name is 2-hydroxy-6-(3-hydroxy-4-methoxy-2-sulfobenzoyl)-3-methoxybenzenesulfonic acid.
| Compound Name | 2-hydroxy-6-(3-hydroxy-4-methoxy-2-sulfobenzoyl)-3-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 21477999 |
| Molecular Formula | C15H14O11S2 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | 2-hydroxy-6-(3-hydroxy-4-methoxy-2-sulfobenzoyl)-3-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(C(=O)c2ccc(OC)c(O)c2S(=O)(=O)O)c(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C15H14O11S2/c1-25-9-5-3-7(14(12(9)17)27(19,20)21)11(16)8-4-6-10(26-2)13(18)15(8)28(22,23)24/h3-6,17-18H,1-2H3,(H,19,20,21)(H,22,23,24) |
| InChIKey | OTKUIMVBJDMTIT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 184.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|