C8H7KO7S — CID 159562719
potassium 2-hydroxy-3-methoxy-6-sulfobenzoate (PubChem CID 159562719) has the molecular formula C8H7KO7S and a molecular weight of 286.30 g/mol. Its IUPAC name is potassium 2-hydroxy-3-methoxy-6-sulfobenzoate.
| Compound Name | potassium 2-hydroxy-3-methoxy-6-sulfobenzoate |
|---|---|
| PubChem CID | 159562719 |
| Molecular Formula | C8H7KO7S |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 285.95 |
| IUPAC Name | potassium 2-hydroxy-3-methoxy-6-sulfobenzoate |
| SMILES | COc1ccc(S(=O)(=O)O)c(C(=O)[O-])c1O.[K+] |
| InChI | InChI=1S/C8H8O7S.K/c1-15-4-2-3-5(16(12,13)14)6(7(4)9)8(10)11;/h2-3,9H,1H3,(H,10,11)(H,12,13,14);/q;+1/p-1 |
| InChIKey | MGUZYGBTVQVWHT-UHFFFAOYSA-M |
| XLogP | -3.98 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|