C8H11NO5S — CID 174958358
2-hydroxy-3,4-dimethoxybenzenesulfonamide (PubChem CID 174958358) has the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. Its IUPAC name is 2-hydroxy-3,4-dimethoxybenzenesulfonamide.
| Compound Name | 2-hydroxy-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 174958358 |
| Molecular Formula | C8H11NO5S |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-hydroxy-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)c(O)c1OC |
| InChI | InChI=1S/C8H11NO5S/c1-13-5-3-4-6(15(9,11)12)7(10)8(5)14-2/h3-4,10H,1-2H3,(H2,9,11,12) |
| InChIKey | QVURRRHCNVMIGU-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |