C11H15NO3 — CID 117298428
6-(1-aminocyclopropyl)-2,3-dimethoxyphenol (PubChem CID 117298428) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 6-(1-aminocyclopropyl)-2,3-dimethoxyphenol.
| Compound Name | 6-(1-aminocyclopropyl)-2,3-dimethoxyphenol |
|---|---|
| PubChem CID | 117298428 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 6-(1-aminocyclopropyl)-2,3-dimethoxyphenol |
| SMILES | COc1ccc(C2(N)CC2)c(O)c1OC |
| InChI | InChI=1S/C11H15NO3/c1-14-8-4-3-7(11(12)5-6-11)9(13)10(8)15-2/h3-4,13H,5-6,12H2,1-2H3 |
| InChIKey | GAJSZESARPBRPZ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|