C15H23NO3 — CID 117417803
6-[1-(aminomethyl)cyclohexyl]-2,3-dimethoxyphenol (PubChem CID 117417803) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 6-[1-(aminomethyl)cyclohexyl]-2,3-dimethoxyphenol.
| Compound Name | 6-[1-(aminomethyl)cyclohexyl]-2,3-dimethoxyphenol |
|---|---|
| PubChem CID | 117417803 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 6-[1-(aminomethyl)cyclohexyl]-2,3-dimethoxyphenol |
| SMILES | COc1ccc(C2(CN)CCCCC2)c(O)c1OC |
| InChI | InChI=1S/C15H23NO3/c1-18-12-7-6-11(13(17)14(12)19-2)15(10-16)8-4-3-5-9-15/h6-7,17H,3-5,8-10,16H2,1-2H3 |
| InChIKey | JUBRMRAHBOBVBJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |