C8H12ClNO4S — CID 142896136
2,3-dimethoxybenzenesulfonamide;hydrochloride (PubChem CID 142896136) has the molecular formula C8H12ClNO4S and a molecular weight of 253.71 g/mol. Its IUPAC name is 2,3-dimethoxybenzenesulfonamide;hydrochloride.
| Compound Name | 2,3-dimethoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 142896136 |
| Molecular Formula | C8H12ClNO4S |
| Molecular Weight | 253.71 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 2,3-dimethoxybenzenesulfonamide;hydrochloride |
| SMILES | COc1cccc(S(N)(=O)=O)c1OC.Cl |
| InChI | InChI=1S/C8H11NO4S.ClH/c1-12-6-4-3-5-7(8(6)13-2)14(9,10)11;/h3-5H,1-2H3,(H2,9,10,11);1H |
| InChIKey | MFXDIGCHVBAYBN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.71 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |