C14H16N2O6S2 — CID 168867113
2-methoxy-3-[(2-methoxyphenyl)sulfonylamino]benzenesulfonamide (PubChem CID 168867113) has the molecular formula C14H16N2O6S2 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-methoxy-3-[(2-methoxyphenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | 2-methoxy-3-[(2-methoxyphenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 168867113 |
| Molecular Formula | C14H16N2O6S2 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 2-methoxy-3-[(2-methoxyphenyl)sulfonylamino]benzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)Nc1cccc(S(N)(=O)=O)c1OC |
| InChI | InChI=1S/C14H16N2O6S2/c1-21-11-7-3-4-8-12(11)24(19,20)16-10-6-5-9-13(14(10)22-2)23(15,17)18/h3-9,16H,1-2H3,(H2,15,17,18) |
| InChIKey | PUDXRPOFDCJHFA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |