C22H24N2O8S2 — CID 17349147
4,6-dimethoxy-1-N,3-N-bis(2-methoxyphenyl)benzene-1,3-disulfonamide (PubChem CID 17349147) has the molecular formula C22H24N2O8S2 and a molecular weight of 508.57 g/mol. Its IUPAC name is 4,6-dimethoxy-1-N,3-N-bis(2-methoxyphenyl)benzene-1,3-disulfonamide.
| Compound Name | 4,6-dimethoxy-1-N,3-N-bis(2-methoxyphenyl)benzene-1,3-disulfonamide |
|---|---|
| PubChem CID | 17349147 |
| Molecular Formula | C22H24N2O8S2 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 4,6-dimethoxy-1-N,3-N-bis(2-methoxyphenyl)benzene-1,3-disulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cc(S(=O)(=O)Nc2ccccc2OC)c(OC)cc1OC |
| InChI | InChI=1S/C22H24N2O8S2/c1-29-17-11-7-5-9-15(17)23-33(25,26)21-14-22(20(32-4)13-19(21)31-3)34(27,28)24-16-10-6-8-12-18(16)30-2/h5-14,23-24H,1-4H3 |
| InChIKey | SWZXAOYVFXVYME-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |