C15H16ClNO4S — CID 163343299
4-chloro-2,5-dimethoxy-N-(2-methylphenyl)benzenesulfonamide (PubChem CID 163343299) has the molecular formula C15H16ClNO4S and a molecular weight of 341.82 g/mol. Its IUPAC name is 4-chloro-2,5-dimethoxy-N-(2-methylphenyl)benzenesulfonamide.
| Compound Name | 4-chloro-2,5-dimethoxy-N-(2-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 163343299 |
| Molecular Formula | C15H16ClNO4S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-chloro-2,5-dimethoxy-N-(2-methylphenyl)benzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)Nc2ccccc2C)c(OC)cc1Cl |
| InChI | InChI=1S/C15H16ClNO4S/c1-10-6-4-5-7-12(10)17-22(18,19)15-9-13(20-2)11(16)8-14(15)21-3/h4-9,17H,1-3H3 |
| InChIKey | AGWMGAJUTHHFBX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |