C9H12O3 — CID 13158257
3,6-dimethoxy-2-methylphenol (PubChem CID 13158257) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is 3,6-dimethoxy-2-methylphenol.
| Compound Name | 3,6-dimethoxy-2-methylphenol |
|---|---|
| PubChem CID | 13158257 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3,6-dimethoxy-2-methylphenol |
| SMILES | COc1ccc(OC)c(O)c1C |
| InChI | InChI=1S/C9H12O3/c1-6-7(11-2)4-5-8(12-3)9(6)10/h4-5,10H,1-3H3 |
| InChIKey | AYGSNWBJTYYNQI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |