C9H13NO2 — CID 58463229
4-amino-6-methoxy-2,3-dimethylphenol (PubChem CID 58463229) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-amino-6-methoxy-2,3-dimethylphenol.
| Compound Name | 4-amino-6-methoxy-2,3-dimethylphenol |
|---|---|
| PubChem CID | 58463229 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 4-amino-6-methoxy-2,3-dimethylphenol |
| SMILES | COc1cc(N)c(C)c(C)c1O |
| InChI | InChI=1S/C9H13NO2/c1-5-6(2)9(11)8(12-3)4-7(5)10/h4,11H,10H2,1-3H3 |
| InChIKey | PLICCUPQRABDBV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|