C9H12O4 — CID 118620662
2,5-dimethoxy-3-methylbenzene-1,4-diol (PubChem CID 118620662) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 2,5-dimethoxy-3-methylbenzene-1,4-diol.
| Compound Name | 2,5-dimethoxy-3-methylbenzene-1,4-diol |
|---|---|
| PubChem CID | 118620662 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2,5-dimethoxy-3-methylbenzene-1,4-diol |
| SMILES | COc1cc(O)c(OC)c(C)c1O |
| InChI | InChI=1S/C9H12O4/c1-5-8(11)7(12-2)4-6(10)9(5)13-3/h4,10-11H,1-3H3 |
| InChIKey | RPRSSGBIGNAUMA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|