C32H48O8 — CID 10325490
3-[(E)-16-(2,5-dihydroxy-3,6-dimethoxyphenyl)hexadec-8-enyl]-2,5-dimethoxybenzene-1,4-diol (PubChem CID 10325490) has the molecular formula C32H48O8 and a molecular weight of 560.73 g/mol. Its IUPAC name is 3-[(E)-16-(2,5-dihydroxy-3,6-dimethoxyphenyl)hexadec-8-enyl]-2,5-dimethoxybenzene-1,4-diol.
| Compound Name | 3-[(E)-16-(2,5-dihydroxy-3,6-dimethoxyphenyl)hexadec-8-enyl]-2,5-dimethoxybenzene-1,4-diol |
|---|---|
| PubChem CID | 10325490 |
| Molecular Formula | C32H48O8 |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | 3-[(E)-16-(2,5-dihydroxy-3,6-dimethoxyphenyl)hexadec-8-enyl]-2,5-dimethoxybenzene-1,4-diol |
| SMILES | COc1cc(O)c(OC)c(CCCCCCC/C=C/CCCCCCCc2c(O)c(OC)cc(O)c2OC)c1O |
| InChI | InChI=1S/C32H48O8/c1-37-27-21-25(33)31(39-3)23(29(27)35)19-17-15-13-11-9-7-5-6-8-10-12-14-16-18-20-24-30(36)28(38-2)22-26(34)32(24)40-4/h5-6,21-22,33-36H,7-20H2,1-4H3/b6-5+ |
| InChIKey | IEFQGTZLCQUKFY-AATRIKPKSA-N |
| XLogP | 7.57 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|