C25H38O4 — CID 10916441
5-ethoxy-3-[(10E,13E)-heptadeca-10,13,16-trienyl]benzene-1,2,4-triol (PubChem CID 10916441) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is 5-ethoxy-3-[(10E,13E)-heptadeca-10,13,16-trienyl]benzene-1,2,4-triol.
| Compound Name | 5-ethoxy-3-[(10E,13E)-heptadeca-10,13,16-trienyl]benzene-1,2,4-triol |
|---|---|
| PubChem CID | 10916441 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | 5-ethoxy-3-[(10E,13E)-heptadeca-10,13,16-trienyl]benzene-1,2,4-triol |
| SMILES | C=CC/C=C/C/C=C/CCCCCCCCCc1c(O)c(O)cc(OCC)c1O |
| InChI | InChI=1S/C25H38O4/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21-24(27)22(26)20-23(25(21)28)29-4-2/h3,6-7,9-10,20,26-28H,1,4-5,8,11-19H2,2H3/b7-6+,10-9+ |
| InChIKey | KFFXCGLJZTXGLX-AVQMFFATSA-N |
| XLogP | 6.94 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|