C22H34O2 — CID 131752491
2-methyl-5-[(8Z,11E)-pentadeca-8,11-dienyl]benzene-1,3-diol (PubChem CID 131752491) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is 2-methyl-5-[(8Z,11E)-pentadeca-8,11-dienyl]benzene-1,3-diol.
| Compound Name | 2-methyl-5-[(8Z,11E)-pentadeca-8,11-dienyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 131752491 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 2-methyl-5-[(8Z,11E)-pentadeca-8,11-dienyl]benzene-1,3-diol |
| SMILES | CCC/C=C/C/C=C\CCCCCCCc1cc(O)c(C)c(O)c1 |
| InChI | InChI=1S/C22H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-17-21(23)19(2)22(24)18-20/h5-6,8-9,17-18,23-24H,3-4,7,10-16H2,1-2H3/b6-5+,9-8- |
| InChIKey | IZGYQWUVUWZOPQ-NKEWZBFXSA-N |
| XLogP | 6.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|