C17H26O2 — CID 71437101
5-undec-3-enylbenzene-1,3-diol (PubChem CID 71437101) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 5-undec-3-enylbenzene-1,3-diol.
| Compound Name | 5-undec-3-enylbenzene-1,3-diol |
|---|---|
| PubChem CID | 71437101 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 5-undec-3-enylbenzene-1,3-diol |
| SMILES | CCCCCCCC=CCCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C17H26O2/c1-2-3-4-5-6-7-8-9-10-11-15-12-16(18)14-17(19)13-15/h8-9,12-14,18-19H,2-7,10-11H2,1H3 |
| InChIKey | KBZMDBAMUVCKBO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|